About 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole
5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole (PubChem CID 167983700) has the molecular formula C13H10N2O2S
and a molecular weight of 258.30 g/mol. Its IUPAC name is 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole |
| PubChem CID | 167983700 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole |
| SMILES | c1ccc(-c2cc(OCc3cncs3)no2)cc1 |
| InChI | InChI=1S/C13H10N2O2S/c1-2-4-10(5-3-1)12-6-13(15-17-12)16-8-11-7-14-9-18-11/h1-7,9H,8H2 |
| InChIKey | RYIZOTDAUVAOPH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole?
The IUPAC name of 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole (CID 167983700) is 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole.
What is the SMILES notation for 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole?
The canonical SMILES for 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole is c1ccc(-c2cc(OCc3cncs3)no2)cc1.
What is the InChIKey of 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole?
The InChIKey is RYIZOTDAUVAOPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2S/c1-2-4-10(5-3-1)12-6-13(15-17-12)16-8-11-7-14-9-18-11/h1-7,9H,8H2.
What are the key properties of 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole?
5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole has a molecular weight of 258.30 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-3-(1,3-thiazol-5-ylmethoxy)-1,2-oxazole is sourced from PubChem (CID 167983700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).