C18H19F2N3O3 — CID 167984017
2-cyclopentylidene-N-[[5-[4-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]methyl]propanamide (PubChem CID 167984017) has the molecular formula C18H19F2N3O3 and a molecular weight of 363.36 g/mol. Its IUPAC name is 2-cyclopentylidene-N-[[5-[4-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]methyl]propanamide.
| Compound Name | 2-cyclopentylidene-N-[[5-[4-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 167984017 |
| Molecular Formula | C18H19F2N3O3 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-cyclopentylidene-N-[[5-[4-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]methyl]propanamide |
| SMILES | CC(C(=O)NCc1noc(-c2ccc(OC(F)F)cc2)n1)=C1CCCC1 |
| InChI | InChI=1S/C18H19F2N3O3/c1-11(12-4-2-3-5-12)16(24)21-10-15-22-17(26-23-15)13-6-8-14(9-7-13)25-18(19)20/h6-9,18H,2-5,10H2,1H3,(H,21,24) |
| InChIKey | WGKJZXNAZITAAU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|