C14H17N5O3S — CID 167985818
1-(1-phenyl-1,2,4-triazole-3-carbonyl)piperidine-3-sulfonamide (PubChem CID 167985818) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is 1-(1-phenyl-1,2,4-triazole-3-carbonyl)piperidine-3-sulfonamide.
| Compound Name | 1-(1-phenyl-1,2,4-triazole-3-carbonyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 167985818 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(1-phenyl-1,2,4-triazole-3-carbonyl)piperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CCCN(C(=O)c2ncn(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C14H17N5O3S/c15-23(21,22)12-7-4-8-18(9-12)14(20)13-16-10-19(17-13)11-5-2-1-3-6-11/h1-3,5-6,10,12H,4,7-9H2,(H2,15,21,22) |
| InChIKey | FUZBUARXZYBIBH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |