C20H26N4O2S — CID 167986052
5-[[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]methyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 167986052) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 5-[[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]methyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]methyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 167986052 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 5-[[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]methyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nnc(CN3CCC[C@@H]4[C@H](O)C(C)(C)[C@@H]43)s2)cc1 |
| InChI | InChI=1S/C20H26N4O2S/c1-12-6-8-13(9-7-12)21-18(26)19-23-22-15(27-19)11-24-10-4-5-14-16(24)20(2,3)17(14)25/h6-9,14,16-17,25H,4-5,10-11H2,1-3H3,(H,21,26)/t14-,16+,17-/m0/s1 |
| InChIKey | CTXWVFUWPZXBOH-UAGQMJEPSA-N |
| XLogP | 3.08 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |