About (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate
(2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate (PubChem CID 167986685) has the molecular formula C19H17N3O4
and a molecular weight of 351.36 g/mol. Its IUPAC name is (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate.
Molecular Properties
| Compound Name | (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate |
| PubChem CID | 167986685 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate |
| SMILES | O=C1NCC(COC(=O)C(c2ccccc2)n2cnc3ccccc32)O1 |
| InChI | InChI=1S/C19H17N3O4/c23-18(25-11-14-10-20-19(24)26-14)17(13-6-2-1-3-7-13)22-12-21-15-8-4-5-9-16(15)22/h1-9,12,14,17H,10-11H2,(H,20,24) |
| InChIKey | ROFOOJUBSVHMDC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate?
The IUPAC name of (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate (CID 167986685) is (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate.
What is the SMILES notation for (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate?
The canonical SMILES for (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate is O=C1NCC(COC(=O)C(c2ccccc2)n2cnc3ccccc32)O1.
What is the InChIKey of (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate?
The InChIKey is ROFOOJUBSVHMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O4/c23-18(25-11-14-10-20-19(24)26-14)17(13-6-2-1-3-7-13)22-12-21-15-8-4-5-9-16(15)22/h1-9,12,14,17H,10-11H2,(H,20,24).
What are the key properties of (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate?
(2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate has a molecular weight of 351.36 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-oxazolidin-5-yl)methyl 2-(benzimidazol-1-yl)-2-phenylacetate is sourced from PubChem (CID 167986685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).