C15H21F6N3O4 — CID 167987144
N-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]-3,3,3-trifluoropropanamide;2,2,2-trifluoroacetic acid (PubChem CID 167987144) has the molecular formula C15H21F6N3O4 and a molecular weight of 421.34 g/mol. Its IUPAC name is N-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]-3,3,3-trifluoropropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]-3,3,3-trifluoropropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167987144 |
| Molecular Formula | C15H21F6N3O4 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]-3,3,3-trifluoropropanamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C/C=C/C(=O)N1CCC(NC(=O)CC(F)(F)F)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O2.C2HF3O2/c1-18(2)6-3-4-12(21)19-7-5-10(9-19)17-11(20)8-13(14,15)16;3-2(4,5)1(6)7/h3-4,10H,5-9H2,1-2H3,(H,17,20);(H,6,7)/b4-3+; |
| InChIKey | JWNMVXZJIKBKGD-BJILWQEISA-N |
| XLogP | 1.41 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|