C20H27N3O — CID 167987751
(2R,3R)-N-(9,9-dimethyl-5,6,7,8-tetrahydrobenzo[7]annulen-6-yl)-2-(1H-pyrazol-5-yl)oxolan-3-amine (PubChem CID 167987751) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is (2R,3R)-N-(9,9-dimethyl-5,6,7,8-tetrahydrobenzo[7]annulen-6-yl)-2-(1H-pyrazol-5-yl)oxolan-3-amine.
| Compound Name | (2R,3R)-N-(9,9-dimethyl-5,6,7,8-tetrahydrobenzo[7]annulen-6-yl)-2-(1H-pyrazol-5-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 167987751 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (2R,3R)-N-(9,9-dimethyl-5,6,7,8-tetrahydrobenzo[7]annulen-6-yl)-2-(1H-pyrazol-5-yl)oxolan-3-amine |
| SMILES | CC1(C)CCC(N[C@@H]2CCO[C@H]2c2ccn[nH]2)Cc2ccccc21 |
| InChI | InChI=1S/C20H27N3O/c1-20(2)10-7-15(13-14-5-3-4-6-16(14)20)22-17-9-12-24-19(17)18-8-11-21-23-18/h3-6,8,11,15,17,19,22H,7,9-10,12-13H2,1-2H3,(H,21,23)/t15?,17-,19-/m1/s1 |
| InChIKey | ZIMCWSZVVVMOSC-GERZZCHPSA-N |
| XLogP | 3.51 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |