About 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one
6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one (PubChem CID 167987804) has the molecular formula C16H12N4O3
and a molecular weight of 308.30 g/mol. Its IUPAC name is 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one |
| PubChem CID | 167987804 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one |
| SMILES | Cc1nc2c(=O)n(Cc3ccc(O)c4ncccc34)cnc2o1 |
| InChI | InChI=1S/C16H12N4O3/c1-9-19-14-15(23-9)18-8-20(16(14)22)7-10-4-5-12(21)13-11(10)3-2-6-17-13/h2-6,8,21H,7H2,1H3 |
| InChIKey | QASRJQGDCCRZMZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one?
The IUPAC name of 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one (CID 167987804) is 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one.
What is the SMILES notation for 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one?
The canonical SMILES for 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one is Cc1nc2c(=O)n(Cc3ccc(O)c4ncccc34)cnc2o1.
What is the InChIKey of 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one?
The InChIKey is QASRJQGDCCRZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O3/c1-9-19-14-15(23-9)18-8-20(16(14)22)7-10-4-5-12(21)13-11(10)3-2-6-17-13/h2-6,8,21H,7H2,1H3.
What are the key properties of 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one?
6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one has a molecular weight of 308.30 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(8-hydroxyquinolin-5-yl)methyl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one is sourced from PubChem (CID 167987804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).