About (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone
(3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone (PubChem CID 167987880) has the molecular formula C10H8FN5OS
and a molecular weight of 265.27 g/mol. Its IUPAC name is (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone.
Molecular Properties
| Compound Name | (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone |
| PubChem CID | 167987880 |
| Molecular Formula | C10H8FN5OS |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone |
| SMILES | O=C(c1csc(-c2nn[nH]n2)c1)N1CC=C(F)C1 |
| InChI | InChI=1S/C10H8FN5OS/c11-7-1-2-16(4-7)10(17)6-3-8(18-5-6)9-12-14-15-13-9/h1,3,5H,2,4H2,(H,12,13,14,15) |
| InChIKey | PUIYQGHJIRFQIK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone?
The IUPAC name of (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone (CID 167987880) is (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone.
What is the SMILES notation for (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone?
The canonical SMILES for (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone is O=C(c1csc(-c2nn[nH]n2)c1)N1CC=C(F)C1.
What is the InChIKey of (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone?
The InChIKey is PUIYQGHJIRFQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN5OS/c11-7-1-2-16(4-7)10(17)6-3-8(18-5-6)9-12-14-15-13-9/h1,3,5H,2,4H2,(H,12,13,14,15).
What are the key properties of (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone?
(3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone has a molecular weight of 265.27 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-2,5-dihydropyrrol-1-yl)-[5-(2H-tetrazol-5-yl)thiophen-3-yl]methanone is sourced from PubChem (CID 167987880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).