C13H12N4O2 — CID 167988505
5-benzyl-N-(1,2-oxazol-3-ylmethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 167988505) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-benzyl-N-(1,2-oxazol-3-ylmethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-benzyl-N-(1,2-oxazol-3-ylmethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 167988505 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-benzyl-N-(1,2-oxazol-3-ylmethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | c1ccc(Cc2nnc(NCc3ccon3)o2)cc1 |
| InChI | InChI=1S/C13H12N4O2/c1-2-4-10(5-3-1)8-12-15-16-13(19-12)14-9-11-6-7-18-17-11/h1-7H,8-9H2,(H,14,16) |
| InChIKey | ZFYWPJZBCBVSAC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |