C13H17F2N3O2 — CID 167988622
N-(3-aminooxypropyl)-5,6-difluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 167988622) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is N-(3-aminooxypropyl)-5,6-difluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | N-(3-aminooxypropyl)-5,6-difluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 167988622 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-(3-aminooxypropyl)-5,6-difluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | NOCCCNC(=O)C1NCCc2c1ccc(F)c2F |
| InChI | InChI=1S/C13H17F2N3O2/c14-10-3-2-9-8(11(10)15)4-6-17-12(9)13(19)18-5-1-7-20-16/h2-3,12,17H,1,4-7,16H2,(H,18,19) |
| InChIKey | PCGWUGCSVIOZKA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|