C28H28N4O2 — CID 167988720
1-N,4-N-bis(isoquinolin-1-ylmethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 167988720) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-N,4-N-bis(isoquinolin-1-ylmethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(isoquinolin-1-ylmethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 167988720 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-N,4-N-bis(isoquinolin-1-ylmethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCc1nccc2ccccc12)C1CCC(C(=O)NCc2nccc3ccccc23)CC1 |
| InChI | InChI=1S/C28H28N4O2/c33-27(31-17-25-23-7-3-1-5-19(23)13-15-29-25)21-9-11-22(12-10-21)28(34)32-18-26-24-8-4-2-6-20(24)14-16-30-26/h1-8,13-16,21-22H,9-12,17-18H2,(H,31,33)(H,32,34) |
| InChIKey | ILUDIGQXJUORBY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |