C18H19N3O4 — CID 167989646
3-(1,3-benzodioxol-5-yl)-N-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]prop-2-ynamide (PubChem CID 167989646) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]prop-2-ynamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]prop-2-ynamide |
|---|---|
| PubChem CID | 167989646 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]prop-2-ynamide |
| SMILES | COCCn1nc(C)c(NC(=O)C#Cc2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C18H19N3O4/c1-12-18(13(2)21(20-12)8-9-23-3)19-17(22)7-5-14-4-6-15-16(10-14)25-11-24-15/h4,6,10H,8-9,11H2,1-3H3,(H,19,22) |
| InChIKey | QTHJVVZDGWNHCZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|