C11H14N6O2 — CID 167989741
2-[3-(2-methyl-1,2,4-triazol-3-yl)propylamino]pyrimidine-5-carboxylic acid (PubChem CID 167989741) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[3-(2-methyl-1,2,4-triazol-3-yl)propylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[3-(2-methyl-1,2,4-triazol-3-yl)propylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 167989741 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-[3-(2-methyl-1,2,4-triazol-3-yl)propylamino]pyrimidine-5-carboxylic acid |
| SMILES | Cn1ncnc1CCCNc1ncc(C(=O)O)cn1 |
| InChI | InChI=1S/C11H14N6O2/c1-17-9(15-7-16-17)3-2-4-12-11-13-5-8(6-14-11)10(18)19/h5-7H,2-4H2,1H3,(H,18,19)(H,12,13,14) |
| InChIKey | SAOPHFBNXUGPNK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|