C18H22N4O — CID 167990005
6-[[(1S,2S)-2-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]cyclohexyl]amino]pyridine-3-carbonitrile (PubChem CID 167990005) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 6-[[(1S,2S)-2-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]cyclohexyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(1S,2S)-2-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]cyclohexyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167990005 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 6-[[(1S,2S)-2-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]cyclohexyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N[C@H]2CCCC[C@H]2CC(=O)N2CC=CC2)nc1 |
| InChI | InChI=1S/C18H22N4O/c19-12-14-7-8-17(20-13-14)21-16-6-2-1-5-15(16)11-18(23)22-9-3-4-10-22/h3-4,7-8,13,15-16H,1-2,5-6,9-11H2,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | XAWAECVIEJUTLW-HOTGVXAUSA-N |
| XLogP | 2.71 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|