C17H25N3O — CID 167990196
2-[(1R,2R)-2-aminocyclohexyl]-1-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethanone (PubChem CID 167990196) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[(1R,2R)-2-aminocyclohexyl]-1-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethanone.
| Compound Name | 2-[(1R,2R)-2-aminocyclohexyl]-1-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethanone |
|---|---|
| PubChem CID | 167990196 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-[(1R,2R)-2-aminocyclohexyl]-1-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethanone |
| SMILES | N[C@@H]1CCCC[C@@H]1CC(=O)N1CCNCc2ccccc21 |
| InChI | InChI=1S/C17H25N3O/c18-15-7-3-1-5-13(15)11-17(21)20-10-9-19-12-14-6-2-4-8-16(14)20/h2,4,6,8,13,15,19H,1,3,5,7,9-12,18H2/t13-,15-/m1/s1 |
| InChIKey | ATANOCICHFUKOJ-UKRRQHHQSA-N |
| XLogP | 2.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |