About 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine
1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine (PubChem CID 167990337) has the molecular formula C11H16N2O3S
and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine |
| PubChem CID | 167990337 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine |
| SMILES | COC(C)CS(=O)(=O)N1CCc2cnccc21 |
| InChI | InChI=1S/C11H16N2O3S/c1-9(16-2)8-17(14,15)13-6-4-10-7-12-5-3-11(10)13/h3,5,7,9H,4,6,8H2,1-2H3 |
| InChIKey | RLQLJIPGFBOXOZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine?
The IUPAC name of 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine (CID 167990337) is 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine.
What is the SMILES notation for 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine?
The canonical SMILES for 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine is COC(C)CS(=O)(=O)N1CCc2cnccc21.
What is the InChIKey of 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine?
The InChIKey is RLQLJIPGFBOXOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S/c1-9(16-2)8-17(14,15)13-6-4-10-7-12-5-3-11(10)13/h3,5,7,9H,4,6,8H2,1-2H3.
What are the key properties of 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine?
1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine has a molecular weight of 256.33 g/mol, XLogP of 0.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxypropylsulfonyl)-2,3-dihydropyrrolo[3,2-c]pyridine is sourced from PubChem (CID 167990337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).