About 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide
5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide (PubChem CID 167990438) has the molecular formula C10H9N3O2S2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide |
| PubChem CID | 167990438 |
| Molecular Formula | C10H9N3O2S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2nc3sccc3s2)N1 |
| InChI | InChI=1S/C10H9N3O2S2/c14-7-2-1-5(11-7)8(15)12-10-13-9-6(17-10)3-4-16-9/h3-5H,1-2H2,(H,11,14)(H,12,13,15) |
| InChIKey | MFWDIWHZLKYTRP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide?
The IUPAC name of 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide (CID 167990438) is 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide.
What is the SMILES notation for 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide?
The canonical SMILES for 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide is O=C1CCC(C(=O)Nc2nc3sccc3s2)N1.
What is the InChIKey of 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide?
The InChIKey is MFWDIWHZLKYTRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2S2/c14-7-2-1-5(11-7)8(15)12-10-13-9-6(17-10)3-4-16-9/h3-5H,1-2H2,(H,11,14)(H,12,13,15).
What are the key properties of 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide?
5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide has a molecular weight of 267.33 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-N-thieno[2,3-d][1,3]thiazol-2-ylpyrrolidine-2-carboxamide is sourced from PubChem (CID 167990438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).