About 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile
3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile (PubChem CID 167992764) has the molecular formula C15H17N5O3S
and a molecular weight of 347.40 g/mol. Its IUPAC name is 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile.
Molecular Properties
| Compound Name | 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile |
| PubChem CID | 167992764 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile |
| SMILES | CS(=O)(=O)[C@@H]1CNC[C@H]1n1cc(COc2cccc(C#N)c2)nn1 |
| InChI | InChI=1S/C15H17N5O3S/c1-24(21,22)15-8-17-7-14(15)20-9-12(18-19-20)10-23-13-4-2-3-11(5-13)6-16/h2-5,9,14-15,17H,7-8,10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | GDKYAJOYPSOLJL-HUUCEWRRSA-N |
| XLogP | 0.29 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile?
The IUPAC name of 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile (CID 167992764) is 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile.
What is the SMILES notation for 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile?
The canonical SMILES for 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile is CS(=O)(=O)[C@@H]1CNC[C@H]1n1cc(COc2cccc(C#N)c2)nn1.
What is the InChIKey of 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile?
The InChIKey is GDKYAJOYPSOLJL-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H17N5O3S/c1-24(21,22)15-8-17-7-14(15)20-9-12(18-19-20)10-23-13-4-2-3-11(5-13)6-16/h2-5,9,14-15,17H,7-8,10H2,1H3/t14-,15-/m1/s1.
What are the key properties of 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile?
3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile has a molecular weight of 347.40 g/mol, XLogP of 0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-[(3R,4R)-4-methylsulfonylpyrrolidin-3-yl]triazol-4-yl]methoxy]benzonitrile is sourced from PubChem (CID 167992764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).