C14H16N8 — CID 167992772
N-(1-benzyltetrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 167992772) has the molecular formula C14H16N8 and a molecular weight of 296.34 g/mol. Its IUPAC name is N-(1-benzyltetrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-(1-benzyltetrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 167992772 |
| Molecular Formula | C14H16N8 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-(1-benzyltetrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | c1ccc(Cn2nnnc2NC2CCc3ncnn3C2)cc1 |
| InChI | InChI=1S/C14H16N8/c1-2-4-11(5-3-1)8-22-14(18-19-20-22)17-12-6-7-13-15-10-16-21(13)9-12/h1-5,10,12H,6-9H2,(H,17,18,20) |
| InChIKey | VWZQWYKAIMZLPD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |