About 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide
3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide (PubChem CID 167992934) has the molecular formula C8H14F2N2O
and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide |
| PubChem CID | 167992934 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC(CC(F)F)C1 |
| InChI | InChI=1S/C8H14F2N2O/c1-11(2)8(13)12-4-6(5-12)3-7(9)10/h6-7H,3-5H2,1-2H3 |
| InChIKey | YJSWARYSORWOSD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide?
The IUPAC name of 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide (CID 167992934) is 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide.
What is the SMILES notation for 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide?
The canonical SMILES for 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide is CN(C)C(=O)N1CC(CC(F)F)C1.
What is the InChIKey of 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide?
The InChIKey is YJSWARYSORWOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O/c1-11(2)8(13)12-4-6(5-12)3-7(9)10/h6-7H,3-5H2,1-2H3.
What are the key properties of 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide?
3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide has a molecular weight of 192.21 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethyl)-N,N-dimethylazetidine-1-carboxamide is sourced from PubChem (CID 167992934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).