About (3-methylindol-1-yl) 2-oxopropanoate
(3-methylindol-1-yl) 2-oxopropanoate (PubChem CID 167993245) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is (3-methylindol-1-yl) 2-oxopropanoate.
Molecular Properties
| Compound Name | (3-methylindol-1-yl) 2-oxopropanoate |
| PubChem CID | 167993245 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (3-methylindol-1-yl) 2-oxopropanoate |
| SMILES | CC(=O)C(=O)On1cc(C)c2ccccc21 |
| InChI | InChI=1S/C12H11NO3/c1-8-7-13(16-12(15)9(2)14)11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
| InChIKey | HDRCYDJIFTTYNE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (3-methylindol-1-yl) 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylindol-1-yl) 2-oxopropanoate?
The IUPAC name of (3-methylindol-1-yl) 2-oxopropanoate (CID 167993245) is (3-methylindol-1-yl) 2-oxopropanoate.
What is the SMILES notation for (3-methylindol-1-yl) 2-oxopropanoate?
The canonical SMILES for (3-methylindol-1-yl) 2-oxopropanoate is CC(=O)C(=O)On1cc(C)c2ccccc21.
What is the InChIKey of (3-methylindol-1-yl) 2-oxopropanoate?
The InChIKey is HDRCYDJIFTTYNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c1-8-7-13(16-12(15)9(2)14)11-6-4-3-5-10(8)11/h3-7H,1-2H3.
What are the key properties of (3-methylindol-1-yl) 2-oxopropanoate?
(3-methylindol-1-yl) 2-oxopropanoate has a molecular weight of 217.22 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylindol-1-yl) 2-oxopropanoate is sourced from PubChem (CID 167993245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).