C17H20N4O2 — CID 167993301
3,3-bis(3,5-dimethylpyrazol-1-yl)-1-(furan-2-yl)propan-1-one (PubChem CID 167993301) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3,3-bis(3,5-dimethylpyrazol-1-yl)-1-(furan-2-yl)propan-1-one.
| Compound Name | 3,3-bis(3,5-dimethylpyrazol-1-yl)-1-(furan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 167993301 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3,3-bis(3,5-dimethylpyrazol-1-yl)-1-(furan-2-yl)propan-1-one |
| SMILES | Cc1cc(C)n(C(CC(=O)c2ccco2)n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C17H20N4O2/c1-11-8-13(3)20(18-11)17(21-14(4)9-12(2)19-21)10-15(22)16-6-5-7-23-16/h5-9,17H,10H2,1-4H3 |
| InChIKey | VEFJBYSZVYLOQZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |