About [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol
[3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol (PubChem CID 167993728) has the molecular formula C12H10F2OS
and a molecular weight of 240.27 g/mol. Its IUPAC name is [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol.
Molecular Properties
| Compound Name | [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol |
| PubChem CID | 167993728 |
| Molecular Formula | C12H10F2OS |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol |
| SMILES | OCc1sccc1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H10F2OS/c13-10-2-1-8(6-11(10)14)5-9-3-4-16-12(9)7-15/h1-4,6,15H,5,7H2 |
| InChIKey | XDLLRVRSDWUVDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol?
The IUPAC name of [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol (CID 167993728) is [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol.
What is the SMILES notation for [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol?
The canonical SMILES for [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol is OCc1sccc1Cc1ccc(F)c(F)c1.
What is the InChIKey of [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol?
The InChIKey is XDLLRVRSDWUVDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2OS/c13-10-2-1-8(6-11(10)14)5-9-3-4-16-12(9)7-15/h1-4,6,15H,5,7H2.
What are the key properties of [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol?
[3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol has a molecular weight of 240.27 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,4-difluorophenyl)methyl]thiophen-2-yl]methanol is sourced from PubChem (CID 167993728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).