About 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide
2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide (PubChem CID 16799376) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide |
| PubChem CID | 16799376 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide |
| SMILES | Cc1ccn2c(=O)c(NC(=O)CC3CCCC3)c(C)nc2c1 |
| InChI | InChI=1S/C17H21N3O2/c1-11-7-8-20-14(9-11)18-12(2)16(17(20)22)19-15(21)10-13-5-3-4-6-13/h7-9,13H,3-6,10H2,1-2H3,(H,19,21) |
| InChIKey | SZAQUHBDTQZFLU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide?
The IUPAC name of 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide (CID 16799376) is 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide.
What is the SMILES notation for 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide?
The canonical SMILES for 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide is Cc1ccn2c(=O)c(NC(=O)CC3CCCC3)c(C)nc2c1.
What is the InChIKey of 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide?
The InChIKey is SZAQUHBDTQZFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-11-7-8-20-14(9-11)18-12(2)16(17(20)22)19-15(21)10-13-5-3-4-6-13/h7-9,13H,3-6,10H2,1-2H3,(H,19,21).
What are the key properties of 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide?
2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide has a molecular weight of 299.37 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-(2,8-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)acetamide is sourced from PubChem (CID 16799376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).