About 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one
3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one (PubChem CID 167997364) has the molecular formula C18H13N3O2
and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one.
Molecular Properties
| Compound Name | 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one |
| PubChem CID | 167997364 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one |
| SMILES | Cc1ccc(-c2noc(C3C=Nc4ccccc4C3=O)n2)cc1 |
| InChI | InChI=1S/C18H13N3O2/c1-11-6-8-12(9-7-11)17-20-18(23-21-17)14-10-19-15-5-3-2-4-13(15)16(14)22/h2-10,14H,1H3 |
| InChIKey | UCBWCVWEAMFHKY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one?
The IUPAC name of 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one (CID 167997364) is 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one.
What is the SMILES notation for 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one?
The canonical SMILES for 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one is Cc1ccc(-c2noc(C3C=Nc4ccccc4C3=O)n2)cc1.
What is the InChIKey of 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one?
The InChIKey is UCBWCVWEAMFHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O2/c1-11-6-8-12(9-7-11)17-20-18(23-21-17)14-10-19-15-5-3-2-4-13(15)16(14)22/h2-10,14H,1H3.
What are the key properties of 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one?
3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one has a molecular weight of 303.32 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3H-quinolin-4-one is sourced from PubChem (CID 167997364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).