C15H17N3O2S2 — CID 167997519
6-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-2-sulfanyl-1,3-diazinan-4-one (PubChem CID 167997519) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 6-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-2-sulfanyl-1,3-diazinan-4-one.
| Compound Name | 6-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-2-sulfanyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 167997519 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 6-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-2-sulfanyl-1,3-diazinan-4-one |
| SMILES | COc1ccc(-c2nc(C)c(C3CC(=O)NC(S)N3)s2)cc1 |
| InChI | InChI=1S/C15H17N3O2S2/c1-8-13(11-7-12(19)18-15(21)17-11)22-14(16-8)9-3-5-10(20-2)6-4-9/h3-6,11,15,17,21H,7H2,1-2H3,(H,18,19) |
| InChIKey | ITLDUVMQJIFBDK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|