C23H27N3O3 — CID 167997659
2-[4-(3,5-dimethylphenyl)-2,3-dioxopiperazin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 167997659) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenyl)-2,3-dioxopiperazin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[4-(3,5-dimethylphenyl)-2,3-dioxopiperazin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 167997659 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-[4-(3,5-dimethylphenyl)-2,3-dioxopiperazin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)CN1CCN(c2cc(C)cc(C)c2)C(=O)C1=O |
| InChI | InChI=1S/C23H27N3O3/c1-5-18-8-6-7-17(4)21(18)24-20(27)14-25-9-10-26(23(29)22(25)28)19-12-15(2)11-16(3)13-19/h6-8,11-13H,5,9-10,14H2,1-4H3,(H,24,27) |
| InChIKey | LILKAEBVRWAKSU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|