C20H15F3N4O3 — CID 167997703
1-phenyl-4-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazine-2,3-dione (PubChem CID 167997703) has the molecular formula C20H15F3N4O3 and a molecular weight of 416.36 g/mol. Its IUPAC name is 1-phenyl-4-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazine-2,3-dione.
| Compound Name | 1-phenyl-4-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 167997703 |
| Molecular Formula | C20H15F3N4O3 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-phenyl-4-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccccc2)CCN1Cc1nc(-c2cccc(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C20H15F3N4O3/c21-20(22,23)14-6-4-5-13(11-14)17-24-16(30-25-17)12-26-9-10-27(19(29)18(26)28)15-7-2-1-3-8-15/h1-8,11H,9-10,12H2 |
| InChIKey | UQVFOCVFMAJLQB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|