C19H31N6O2+ — CID 167997900
3,4,7,9-tetramethyl-1-octyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167997900) has the molecular formula C19H31N6O2+ and a molecular weight of 375.50 g/mol. Its IUPAC name is 3,4,7,9-tetramethyl-1-octyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3,4,7,9-tetramethyl-1-octyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167997900 |
| Molecular Formula | C19H31N6O2+ |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 3,4,7,9-tetramethyl-1-octyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CCCCCCCCN1N=C(C)C(C)[N+]2=C1N=C1C2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C19H31N6O2/c1-6-7-8-9-10-11-12-24-18-20-16-15(25(18)14(3)13(2)21-24)17(26)23(5)19(27)22(16)4/h14-15H,6-12H2,1-5H3/q+1 |
| InChIKey | XDOOQJMNGAMFRU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|