C19H20N4O5S — CID 167998074
2,4-dioxo-N-(2-pyridin-3-yloxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-6-sulfonamide (PubChem CID 167998074) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2,4-dioxo-N-(2-pyridin-3-yloxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-6-sulfonamide.
| Compound Name | 2,4-dioxo-N-(2-pyridin-3-yloxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 167998074 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2,4-dioxo-N-(2-pyridin-3-yloxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-6-sulfonamide |
| SMILES | O=C1NC(=O)C2CC(S(=O)(=O)Nc3ccccc3Oc3cccnc3)CCC2N1 |
| InChI | InChI=1S/C19H20N4O5S/c24-18-14-10-13(7-8-15(14)21-19(25)22-18)29(26,27)23-16-5-1-2-6-17(16)28-12-4-3-9-20-11-12/h1-6,9,11,13-15,23H,7-8,10H2,(H2,21,22,24,25) |
| InChIKey | LAVTYZHPZQCXLD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |