C20H26N6O5 — CID 167998317
ethyl 4-[2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]piperazine-1-carboxylate (PubChem CID 167998317) has the molecular formula C20H26N6O5 and a molecular weight of 430.47 g/mol. Its IUPAC name is ethyl 4-[2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167998317 |
| Molecular Formula | C20H26N6O5 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | ethyl 4-[2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN2NC3N(CCN3c3ccccc3)C(=O)C2=O)CC1 |
| InChI | InChI=1S/C20H26N6O5/c1-2-31-20(30)23-10-8-22(9-11-23)16(27)14-26-18(29)17(28)25-13-12-24(19(25)21-26)15-6-4-3-5-7-15/h3-7,19,21H,2,8-14H2,1H3 |
| InChIKey | GHDKPXZAIMRGRJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|