C20H24N4O3 — CID 167998582
6-ethyl-5-[2-(2-methoxyphenyl)ethylimino]-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 167998582) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 6-ethyl-5-[2-(2-methoxyphenyl)ethylimino]-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-ethyl-5-[2-(2-methoxyphenyl)ethylimino]-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167998582 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 6-ethyl-5-[2-(2-methoxyphenyl)ethylimino]-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCC1=CN=C2C(C(=O)N(C)C(=O)N2C)/C1=N/CCc1ccccc1OC |
| InChI | InChI=1S/C20H24N4O3/c1-5-13-12-22-18-16(19(25)24(3)20(26)23(18)2)17(13)21-11-10-14-8-6-7-9-15(14)27-4/h6-9,12,16H,5,10-11H2,1-4H3/b21-17+ |
| InChIKey | NXTWAZOVRQYOTA-HEHNFIMWSA-N |
| XLogP | 2.52 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|