C14H15N3OS — CID 167998628
5-but-2-ynyl-2-thiophen-2-yl-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 167998628) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 5-but-2-ynyl-2-thiophen-2-yl-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-but-2-ynyl-2-thiophen-2-yl-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 167998628 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-but-2-ynyl-2-thiophen-2-yl-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CC#CCN1C=CN2NC(c3cccs3)CC2C1=O |
| InChI | InChI=1S/C14H15N3OS/c1-2-3-6-16-7-8-17-12(14(16)18)10-11(15-17)13-5-4-9-19-13/h4-5,7-9,11-12,15H,6,10H2,1H3 |
| InChIKey | BTKXBPVCFVZQEH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|