C14H20N5O2+ — CID 167999609
9-[(E)-but-2-enyl]-1,3-dimethyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-9-ium-2,4-dione (PubChem CID 167999609) has the molecular formula C14H20N5O2+ and a molecular weight of 290.35 g/mol. Its IUPAC name is 9-[(E)-but-2-enyl]-1,3-dimethyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-9-ium-2,4-dione.
| Compound Name | 9-[(E)-but-2-enyl]-1,3-dimethyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-9-ium-2,4-dione |
|---|---|
| PubChem CID | 167999609 |
| Molecular Formula | C14H20N5O2+ |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 9-[(E)-but-2-enyl]-1,3-dimethyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-9-ium-2,4-dione |
| SMILES | C/C=C/C[N+]1=C2N=C3C(C(=O)N(C)C(=O)N3C)N2CCC1 |
| InChI | InChI=1S/C14H20N5O2/c1-4-5-7-18-8-6-9-19-10-11(15-13(18)19)16(2)14(21)17(3)12(10)20/h4-5,10H,6-9H2,1-3H3/q+1/b5-4+ |
| InChIKey | FPJWHXCNNHUOSR-SNAWJCMRSA-N |
| XLogP | -0.06 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|