About N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride
N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride (PubChem CID 16800373) has the molecular formula C12H13Cl2N3
and a molecular weight of 270.16 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride |
| PubChem CID | 16800373 |
| Molecular Formula | C12H13Cl2N3 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride |
| SMILES | Cc1cc(C)nc(Nc2ccccc2Cl)n1.Cl |
| InChI | InChI=1S/C12H12ClN3.ClH/c1-8-7-9(2)15-12(14-8)16-11-6-4-3-5-10(11)13;/h3-7H,1-2H3,(H,14,15,16);1H |
| InChIKey | RUNXOMWVXGJWPS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride?
The IUPAC name of N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride (CID 16800373) is N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride.
What is the SMILES notation for N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride?
The canonical SMILES for N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride is Cc1cc(C)nc(Nc2ccccc2Cl)n1.Cl.
What is the InChIKey of N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride?
The InChIKey is RUNXOMWVXGJWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3.ClH/c1-8-7-9(2)15-12(14-8)16-11-6-4-3-5-10(11)13;/h3-7H,1-2H3,(H,14,15,16);1H.
What are the key properties of N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride?
N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride has a molecular weight of 270.16 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-4,6-dimethylpyrimidin-2-amine;hydrochloride is sourced from PubChem (CID 16800373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).