C20H25N5O3 — CID 16802672
8-(cyclohexylamino)-7-(2-hydroxy-2-phenylethyl)-3-methylpurine-2,6-dione (PubChem CID 16802672) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 8-(cyclohexylamino)-7-(2-hydroxy-2-phenylethyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-7-(2-hydroxy-2-phenylethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 16802672 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 8-(cyclohexylamino)-7-(2-hydroxy-2-phenylethyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NC1CCCCC1)n2CC(O)c1ccccc1 |
| InChI | InChI=1S/C20H25N5O3/c1-24-17-16(18(27)23-20(24)28)25(12-15(26)13-8-4-2-5-9-13)19(22-17)21-14-10-6-3-7-11-14/h2,4-5,8-9,14-15,26H,3,6-7,10-12H2,1H3,(H,21,22)(H,23,27,28) |
| InChIKey | YGGTXLIZCUCZND-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |