C26H30N2O4 — CID 16802996
5-[(2,5-dimethylphenyl)methoxy]-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]pyran-4-one (PubChem CID 16802996) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)methoxy]-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]pyran-4-one.
| Compound Name | 5-[(2,5-dimethylphenyl)methoxy]-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 16802996 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)methoxy]-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]pyran-4-one |
| SMILES | COc1ccc(N2CCN(Cc3cc(=O)c(OCc4cc(C)ccc4C)co3)CC2)cc1 |
| InChI | InChI=1S/C26H30N2O4/c1-19-4-5-20(2)21(14-19)17-32-26-18-31-24(15-25(26)29)16-27-10-12-28(13-11-27)22-6-8-23(30-3)9-7-22/h4-9,14-15,18H,10-13,16-17H2,1-3H3 |
| InChIKey | BSYJZRHLQKIMDI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|