C12H8N2O — CID 16803
2-pyridin-3-yl-1,3-benzoxazole (PubChem CID 16803) has the molecular formula C12H8N2O and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-pyridin-3-yl-1,3-benzoxazole.
| Compound Name | 2-pyridin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 16803 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-pyridin-3-yl-1,3-benzoxazole |
| SMILES | c1cncc(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C12H8N2O/c1-2-6-11-10(5-1)14-12(15-11)9-4-3-7-13-8-9/h1-8H |
| InChIKey | GTVLGQYUIJMHMA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |