C15H20N2O3S — CID 16804806
3-(2,5-dimethylphenyl)-1-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one (PubChem CID 16804806) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 3-(2,5-dimethylphenyl)-1-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 16804806 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CCN1C(=O)N(c2cc(C)ccc2C)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C15H20N2O3S/c1-4-16-13-8-21(19,20)9-14(13)17(15(16)18)12-7-10(2)5-6-11(12)3/h5-7,13-14H,4,8-9H2,1-3H3 |
| InChIKey | BLELCEJYUSWZBB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|