C17H25N5O2 — CID 16805011
6-butan-2-yl-2-butyl-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 16805011) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 6-butan-2-yl-2-butyl-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-butan-2-yl-2-butyl-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 16805011 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 6-butan-2-yl-2-butyl-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCn1c(=O)c2c(nc3n(C(C)CC)c(C)cn23)n(C)c1=O |
| InChI | InChI=1S/C17H25N5O2/c1-6-8-9-20-15(23)13-14(19(5)17(20)24)18-16-21(13)10-12(4)22(16)11(3)7-2/h10-11H,6-9H2,1-5H3 |
| InChIKey | ANDVIBWENLCLQE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |