C23H23ClFN3O2 — CID 16809868
4-chloro-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]benzamide (PubChem CID 16809868) has the molecular formula C23H23ClFN3O2 and a molecular weight of 427.91 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 16809868 |
| Molecular Formula | C23H23ClFN3O2 |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-chloro-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]benzamide |
| SMILES | O=C(NCC(c1ccco1)N1CCN(c2ccc(F)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClFN3O2/c24-18-5-3-17(4-6-18)23(29)26-16-21(22-2-1-15-30-22)28-13-11-27(12-14-28)20-9-7-19(25)8-10-20/h1-10,15,21H,11-14,16H2,(H,26,29) |
| InChIKey | WMBXOIFUZHWEAI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |