C19H20ClN5O2 — CID 16812037
6-(2-chloroethyl)-4,7-dimethyl-2-(2-phenylethyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 16812037) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 6-(2-chloroethyl)-4,7-dimethyl-2-(2-phenylethyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(2-chloroethyl)-4,7-dimethyl-2-(2-phenylethyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 16812037 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 6-(2-chloroethyl)-4,7-dimethyl-2-(2-phenylethyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cn2c3c(=O)n(CCc4ccccc4)c(=O)n(C)c3nc2n1CCCl |
| InChI | InChI=1S/C19H20ClN5O2/c1-13-12-25-15-16(21-18(25)23(13)11-9-20)22(2)19(27)24(17(15)26)10-8-14-6-4-3-5-7-14/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | LYIMDWYRLVCSOG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|