About 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione
6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 16812064) has the molecular formula C20H13ClFN5O2
and a molecular weight of 409.81 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione |
| PubChem CID | 16812064 |
| Molecular Formula | C20H13ClFN5O2 |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc1n(-c3ccc(Cl)cc3)c(-c3ccc(F)cc3)cn21 |
| InChI | InChI=1S/C20H13ClFN5O2/c1-25-17-16(18(28)24-20(25)29)26-10-15(11-2-6-13(22)7-3-11)27(19(26)23-17)14-8-4-12(21)5-9-14/h2-10H,1H3,(H,24,28,29) |
| InChIKey | WLMBELCATLFPQD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione?
The IUPAC name of 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione (CID 16812064) is 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione.
What is the SMILES notation for 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione?
The canonical SMILES for 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione is Cn1c(=O)[nH]c(=O)c2c1nc1n(-c3ccc(Cl)cc3)c(-c3ccc(F)cc3)cn21.
What is the InChIKey of 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione?
The InChIKey is WLMBELCATLFPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClFN5O2/c1-25-17-16(18(28)24-20(25)29)26-10-15(11-2-6-13(22)7-3-11)27(19(26)23-17)14-8-4-12(21)5-9-14/h2-10H,1H3,(H,24,28,29).
What are the key properties of 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione?
6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione has a molecular weight of 409.81 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-7-(4-fluorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione is sourced from PubChem (CID 16812064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).