C23H25N3O5 — CID 16812603
N-(2,5-dimethoxyphenyl)-2-(2-morpholin-4-ylquinolin-8-yl)oxyacetamide (PubChem CID 16812603) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(2-morpholin-4-ylquinolin-8-yl)oxyacetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(2-morpholin-4-ylquinolin-8-yl)oxyacetamide |
|---|---|
| PubChem CID | 16812603 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(2-morpholin-4-ylquinolin-8-yl)oxyacetamide |
| SMILES | COc1ccc(OC)c(NC(=O)COc2cccc3ccc(N4CCOCC4)nc23)c1 |
| InChI | InChI=1S/C23H25N3O5/c1-28-17-7-8-19(29-2)18(14-17)24-22(27)15-31-20-5-3-4-16-6-9-21(25-23(16)20)26-10-12-30-13-11-26/h3-9,14H,10-13,15H2,1-2H3,(H,24,27) |
| InChIKey | WWSXUPDUUNWAJK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |