About 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide
9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 16815187) has the molecular formula C20H15Cl2N5O3
and a molecular weight of 444.28 g/mol. Its IUPAC name is 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide.
Molecular Properties
| Compound Name | 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| PubChem CID | 16815187 |
| Molecular Formula | C20H15Cl2N5O3 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCOc1ccccc1-c1nc(C(N)=O)c2[nH]c(=O)n(-c3ccc(Cl)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C20H15Cl2N5O3/c1-2-30-14-6-4-3-5-11(14)18-24-15(17(23)28)16-19(26-18)27(20(29)25-16)10-7-8-12(21)13(22)9-10/h3-9H,2H2,1H3,(H2,23,28)(H,25,29) |
| InChIKey | UTORUOPNPJHJEM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide?
The IUPAC name of 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide (CID 16815187) is 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide.
What is the SMILES notation for 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide?
The canonical SMILES for 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide is CCOc1ccccc1-c1nc(C(N)=O)c2[nH]c(=O)n(-c3ccc(Cl)c(Cl)c3)c2n1.
What is the InChIKey of 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide?
The InChIKey is UTORUOPNPJHJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N5O3/c1-2-30-14-6-4-3-5-11(14)18-24-15(17(23)28)16-19(26-18)27(20(29)25-16)10-7-8-12(21)13(22)9-10/h3-9H,2H2,1H3,(H2,23,28)(H,25,29).
What are the key properties of 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide?
9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide has a molecular weight of 444.28 g/mol, XLogP of 3.58, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,4-dichlorophenyl)-2-(2-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide is sourced from PubChem (CID 16815187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).