C18H12FN7O4 — CID 16815709
2-[3-(3-fluorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 16815709) has the molecular formula C18H12FN7O4 and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-[3-(3-fluorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[3-(3-fluorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16815709 |
| Molecular Formula | C18H12FN7O4 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-[3-(3-fluorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cn1cnc2c(nnn2-c2cccc(F)c2)c1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12FN7O4/c19-11-2-1-3-14(8-11)25-17-16(22-23-25)18(28)24(10-20-17)9-15(27)21-12-4-6-13(7-5-12)26(29)30/h1-8,10H,9H2,(H,21,27) |
| InChIKey | INAAWGMOISVBTC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|