C18H21N5O5S — CID 16819505
2-methyl-3-nitro-N-[[5-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide (PubChem CID 16819505) has the molecular formula C18H21N5O5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[[5-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide.
| Compound Name | 2-methyl-3-nitro-N-[[5-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 16819505 |
| Molecular Formula | C18H21N5O5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-methyl-3-nitro-N-[[5-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide |
| SMILES | Cc1c(C(=O)NCc2nnc(SCC(=O)N3CCCCC3)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N5O5S/c1-12-13(6-5-7-14(12)23(26)27)17(25)19-10-15-20-21-18(28-15)29-11-16(24)22-8-3-2-4-9-22/h5-7H,2-4,8-11H2,1H3,(H,19,25) |
| InChIKey | OMHKGSSDUGMQHT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|