About 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide
2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide (PubChem CID 16820282) has the molecular formula C13H12N4O2
and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide |
| PubChem CID | 16820282 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide |
| SMILES | Cc1nnc(-c2cc3ccccc3n2CC(N)=O)o1 |
| InChI | InChI=1S/C13H12N4O2/c1-8-15-16-13(19-8)11-6-9-4-2-3-5-10(9)17(11)7-12(14)18/h2-6H,7H2,1H3,(H2,14,18) |
| InChIKey | SEZOJPQLAONAKR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide?
The IUPAC name of 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide (CID 16820282) is 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide.
What is the SMILES notation for 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide?
The canonical SMILES for 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide is Cc1nnc(-c2cc3ccccc3n2CC(N)=O)o1.
What is the InChIKey of 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide?
The InChIKey is SEZOJPQLAONAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2/c1-8-15-16-13(19-8)11-6-9-4-2-3-5-10(9)17(11)7-12(14)18/h2-6H,7H2,1H3,(H2,14,18).
What are the key properties of 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide?
2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide has a molecular weight of 256.26 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5-methyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetamide is sourced from PubChem (CID 16820282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).