About N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide
N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide (PubChem CID 16820558) has the molecular formula C11H14N2O3S
and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide |
| PubChem CID | 16820558 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide |
| SMILES | CN1C(=O)CCc2cc(NS(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C11H14N2O3S/c1-13-10-5-4-9(12-17(2,15)16)7-8(10)3-6-11(13)14/h4-5,7,12H,3,6H2,1-2H3 |
| InChIKey | RLWCZXBLKIKJJU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide?
The IUPAC name of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide (CID 16820558) is N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide.
What is the SMILES notation for N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide?
The canonical SMILES for N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide is CN1C(=O)CCc2cc(NS(C)(=O)=O)ccc21.
What is the InChIKey of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide?
The InChIKey is RLWCZXBLKIKJJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S/c1-13-10-5-4-9(12-17(2,15)16)7-8(10)3-6-11(13)14/h4-5,7,12H,3,6H2,1-2H3.
What are the key properties of N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide?
N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide has a molecular weight of 254.31 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methanesulfonamide is sourced from PubChem (CID 16820558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).